C25H18ClN3O6S2 — CID 67969992
N-[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]-6-phenoxypyridine-3-sulfonamide (PubChem CID 67969992) has the molecular formula C25H18ClN3O6S2 and a molecular weight of 556.02 g/mol. Its IUPAC name is N-[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]-6-phenoxypyridine-3-sulfonamide.
| Compound Name | N-[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]-6-phenoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 67969992 |
| Molecular Formula | C25H18ClN3O6S2 |
| Molecular Weight | 556.02 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | N-[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]-6-phenoxypyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1NS(=O)(=O)c1cc2ccccc2o1)c1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C25H18ClN3O6S2/c26-18-10-12-21(22(15-18)29-37(32,33)25-14-17-6-4-5-9-23(17)35-25)28-36(30,31)20-11-13-24(27-16-20)34-19-7-2-1-3-8-19/h1-16,28-29H |
| InChIKey | WWMVZIJSIHYDTE-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.02 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |