C20H19ClN6O — CID 113043874
4-chloro-N-[6-(4-pyridin-2-ylpiperazin-1-yl)pyridazin-3-yl]benzamide (PubChem CID 113043874) has the molecular formula C20H19ClN6O and a molecular weight of 394.87 g/mol. Its IUPAC name is 4-chloro-N-[6-(4-pyridin-2-ylpiperazin-1-yl)pyridazin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[6-(4-pyridin-2-ylpiperazin-1-yl)pyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 113043874 |
| Molecular Formula | C20H19ClN6O |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 4-chloro-N-[6-(4-pyridin-2-ylpiperazin-1-yl)pyridazin-3-yl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3ccccn3)CC2)nn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN6O/c21-16-6-4-15(5-7-16)20(28)23-17-8-9-19(25-24-17)27-13-11-26(12-14-27)18-3-1-2-10-22-18/h1-10H,11-14H2,(H,23,24,28) |
| InChIKey | OQUKDXDHGXGNCS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |