C15H16N6O2 — CID 113040477
N-[6-(4-formylpiperazin-1-yl)pyridazin-3-yl]pyridine-3-carboxamide (PubChem CID 113040477) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[6-(4-formylpiperazin-1-yl)pyridazin-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[6-(4-formylpiperazin-1-yl)pyridazin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113040477 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[6-(4-formylpiperazin-1-yl)pyridazin-3-yl]pyridine-3-carboxamide |
| SMILES | O=CN1CCN(c2ccc(NC(=O)c3cccnc3)nn2)CC1 |
| InChI | InChI=1S/C15H16N6O2/c22-11-20-6-8-21(9-7-20)14-4-3-13(18-19-14)17-15(23)12-2-1-5-16-10-12/h1-5,10-11H,6-9H2,(H,17,18,23) |
| InChIKey | HHXVUUOUUWFHBC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|