C19H19N7O — CID 122347312
pyridin-3-yl-[4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone (PubChem CID 122347312) has the molecular formula C19H19N7O and a molecular weight of 361.41 g/mol. Its IUPAC name is pyridin-3-yl-[4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone.
| Compound Name | pyridin-3-yl-[4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122347312 |
| Molecular Formula | C19H19N7O |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | pyridin-3-yl-[4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cccnc1)N1CCN(c2ccc(Nc3ccccn3)nn2)CC1 |
| InChI | InChI=1S/C19H19N7O/c27-19(15-4-3-8-20-14-15)26-12-10-25(11-13-26)18-7-6-17(23-24-18)22-16-5-1-2-9-21-16/h1-9,14H,10-13H2,(H,21,22,23) |
| InChIKey | LEAODVBNYLLUSW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |