C19H20N8O — CID 122347475
(5-methylpyrazin-2-yl)-[4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone (PubChem CID 122347475) has the molecular formula C19H20N8O and a molecular weight of 376.42 g/mol. Its IUPAC name is (5-methylpyrazin-2-yl)-[4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone.
| Compound Name | (5-methylpyrazin-2-yl)-[4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122347475 |
| Molecular Formula | C19H20N8O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (5-methylpyrazin-2-yl)-[4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
| SMILES | Cc1cnc(C(=O)N2CCN(c3ccc(Nc4ccccn4)nn3)CC2)cn1 |
| InChI | InChI=1S/C19H20N8O/c1-14-12-22-15(13-21-14)19(28)27-10-8-26(9-11-27)18-6-5-17(24-25-18)23-16-4-2-3-7-20-16/h2-7,12-13H,8-11H2,1H3,(H,20,23,24) |
| InChIKey | RYMMQRHFGNFMHM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |