C17H17Cl2N5O2 — CID 113040560
N-[6-(4-acetylpiperazin-1-yl)pyridazin-3-yl]-3,4-dichlorobenzamide (PubChem CID 113040560) has the molecular formula C17H17Cl2N5O2 and a molecular weight of 394.26 g/mol. Its IUPAC name is N-[6-(4-acetylpiperazin-1-yl)pyridazin-3-yl]-3,4-dichlorobenzamide.
| Compound Name | N-[6-(4-acetylpiperazin-1-yl)pyridazin-3-yl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 113040560 |
| Molecular Formula | C17H17Cl2N5O2 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[6-(4-acetylpiperazin-1-yl)pyridazin-3-yl]-3,4-dichlorobenzamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)nn2)CC1 |
| InChI | InChI=1S/C17H17Cl2N5O2/c1-11(25)23-6-8-24(9-7-23)16-5-4-15(21-22-16)20-17(26)12-2-3-13(18)14(19)10-12/h2-5,10H,6-9H2,1H3,(H,20,21,26) |
| InChIKey | DEYXVHYOFXELCP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |