C15H21N7O2S — CID 113043895
3-(dimethylsulfamoylamino)-6-(4-pyridin-2-ylpiperazin-1-yl)pyridazine (PubChem CID 113043895) has the molecular formula C15H21N7O2S and a molecular weight of 363.45 g/mol. Its IUPAC name is 3-(dimethylsulfamoylamino)-6-(4-pyridin-2-ylpiperazin-1-yl)pyridazine.
| Compound Name | 3-(dimethylsulfamoylamino)-6-(4-pyridin-2-ylpiperazin-1-yl)pyridazine |
|---|---|
| PubChem CID | 113043895 |
| Molecular Formula | C15H21N7O2S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-(dimethylsulfamoylamino)-6-(4-pyridin-2-ylpiperazin-1-yl)pyridazine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(N2CCN(c3ccccn3)CC2)nn1 |
| InChI | InChI=1S/C15H21N7O2S/c1-20(2)25(23,24)19-13-6-7-15(18-17-13)22-11-9-21(10-12-22)14-5-3-4-8-16-14/h3-8H,9-12H2,1-2H3,(H,17,19) |
| InChIKey | MHWOGSMKEKLUBH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |