C16H21FN6O2S — CID 113043785
3-(dimethylsulfamoylamino)-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine (PubChem CID 113043785) has the molecular formula C16H21FN6O2S and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-(dimethylsulfamoylamino)-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine.
| Compound Name | 3-(dimethylsulfamoylamino)-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 113043785 |
| Molecular Formula | C16H21FN6O2S |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3-(dimethylsulfamoylamino)-6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(N2CCN(c3ccccc3F)CC2)nn1 |
| InChI | InChI=1S/C16H21FN6O2S/c1-21(2)26(24,25)20-15-7-8-16(19-18-15)23-11-9-22(10-12-23)14-6-4-3-5-13(14)17/h3-8H,9-12H2,1-2H3,(H,18,20) |
| InChIKey | GWNIWLHFIPLKJX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |