C19H18FN5O2 — CID 113043760
N-[6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]furan-2-carboxamide (PubChem CID 113043760) has the molecular formula C19H18FN5O2 and a molecular weight of 367.38 g/mol. Its IUPAC name is N-[6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]furan-2-carboxamide.
| Compound Name | N-[6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113043760 |
| Molecular Formula | C19H18FN5O2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[6-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3ccccc3F)CC2)nn1)c1ccco1 |
| InChI | InChI=1S/C19H18FN5O2/c20-14-4-1-2-5-15(14)24-9-11-25(12-10-24)18-8-7-17(22-23-18)21-19(26)16-6-3-13-27-16/h1-8,13H,9-12H2,(H,21,22,26) |
| InChIKey | SJYQSTJNOBZPEB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |