C15H10F2N4O2 — CID 113050490
N-[6-(2,4-difluoroanilino)pyridazin-3-yl]furan-2-carboxamide (PubChem CID 113050490) has the molecular formula C15H10F2N4O2 and a molecular weight of 316.27 g/mol. Its IUPAC name is N-[6-(2,4-difluoroanilino)pyridazin-3-yl]furan-2-carboxamide.
| Compound Name | N-[6-(2,4-difluoroanilino)pyridazin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113050490 |
| Molecular Formula | C15H10F2N4O2 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-[6-(2,4-difluoroanilino)pyridazin-3-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(F)cc2F)nn1)c1ccco1 |
| InChI | InChI=1S/C15H10F2N4O2/c16-9-3-4-11(10(17)8-9)18-13-5-6-14(21-20-13)19-15(22)12-2-1-7-23-12/h1-8H,(H,18,20)(H,19,21,22) |
| InChIKey | JIMKGCIHWHPPLO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |