C18H21N3O4S — CID 24997264
2,4-dimethyl-N-[(6-morpholin-4-yl-3-pyridinyl)sulfonyl]benzamide (PubChem CID 24997264) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(6-morpholin-4-yl-3-pyridinyl)sulfonyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[(6-morpholin-4-yl-3-pyridinyl)sulfonyl]benzamide |
|---|---|
| PubChem CID | 24997264 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2,4-dimethyl-N-[(6-morpholin-4-yl-3-pyridinyl)sulfonyl]benzamide |
| SMILES | Cc1ccc(C(=O)NS(=O)(=O)c2ccc(N3CCOCC3)nc2)c(C)c1 |
| InChI | InChI=1S/C18H21N3O4S/c1-13-3-5-16(14(2)11-13)18(22)20-26(23,24)15-4-6-17(19-12-15)21-7-9-25-10-8-21/h3-6,11-12H,7-10H2,1-2H3,(H,20,22) |
| InChIKey | BAVZFAJKPWGJAR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |