C28H24Cl2N2O7S2 — CID 99667613
ethyl (2S)-2-[1,4-bis[(4-chlorophenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate (PubChem CID 99667613) has the molecular formula C28H24Cl2N2O7S2 and a molecular weight of 635.55 g/mol. Its IUPAC name is ethyl (2S)-2-[1,4-bis[(4-chlorophenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate.
| Compound Name | ethyl (2S)-2-[1,4-bis[(4-chlorophenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 99667613 |
| Molecular Formula | C28H24Cl2N2O7S2 |
| Molecular Weight | 635.55 g/mol |
| Exact Mass | 634.04 |
| IUPAC Name | ethyl (2S)-2-[1,4-bis[(4-chlorophenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)[C@H](C(C)=O)c1cc(NS(=O)(=O)c2ccc(Cl)cc2)c2ccccc2c1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H24Cl2N2O7S2/c1-3-39-28(34)26(17(2)33)24-16-25(31-40(35,36)20-12-8-18(29)9-13-20)22-6-4-5-7-23(22)27(24)32-41(37,38)21-14-10-19(30)11-15-21/h4-16,26,31-32H,3H2,1-2H3/t26-/m1/s1 |
| InChIKey | UYHFLFYRGWPHRD-AREMUKBSSA-N |
| XLogP | 5.98 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|