C28H22N2O4S2 — CID 67903591
N-(4-amino-9,10-dioxo-3-phenylsulfanylanthracen-2-yl)-4-ethylbenzenesulfonamide (PubChem CID 67903591) has the molecular formula C28H22N2O4S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is N-(4-amino-9,10-dioxo-3-phenylsulfanylanthracen-2-yl)-4-ethylbenzenesulfonamide.
| Compound Name | N-(4-amino-9,10-dioxo-3-phenylsulfanylanthracen-2-yl)-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 67903591 |
| Molecular Formula | C28H22N2O4S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | N-(4-amino-9,10-dioxo-3-phenylsulfanylanthracen-2-yl)-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc3c(c(N)c2Sc2ccccc2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C28H22N2O4S2/c1-2-17-12-14-19(15-13-17)36(33,34)30-23-16-22-24(25(29)28(23)35-18-8-4-3-5-9-18)27(32)21-11-7-6-10-20(21)26(22)31/h3-16,30H,2,29H2,1H3 |
| InChIKey | IYPZLPWSRYKGOE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|