9-oxofluorene-4-carbonyl chloride

C14H7ClO2 — CID 610142

IUPAC9-oxofluorene-4-carbonyl chloride
SMILESO=C(Cl)c1cccc2c1-c1ccccc1C2=O
InChIInChI=1S/C14H7ClO2/c15-14(17)11-7-3-6-10-12(11)8-4-1-2-5-9(8)13(10)16/h1-7H
InChIKeyXKCGWCQMEUASJF-UHFFFAOYSA-N
MW242.66 g/mol
LogP3.28
Rot. Bonds1

About 9-oxofluorene-4-carbonyl chloride

9-oxofluorene-4-carbonyl chloride (PubChem CID 610142) has the molecular formula C14H7ClO2 and a molecular weight of 242.66 g/mol. Its IUPAC name is 9-oxofluorene-4-carbonyl chloride.

Molecular Properties

Compound Name9-oxofluorene-4-carbonyl chloride
PubChem CID610142
Molecular FormulaC14H7ClO2
Molecular Weight242.66 g/mol
Exact Mass242.01
IUPAC Name9-oxofluorene-4-carbonyl chloride
SMILESO=C(Cl)c1cccc2c1-c1ccccc1C2=O
InChIInChI=1S/C14H7ClO2/c15-14(17)11-7-3-6-10-12(11)8-4-1-2-5-9(8)13(10)16/h1-7H
InChIKeyXKCGWCQMEUASJF-UHFFFAOYSA-N
XLogP3.28
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.66
LogP ≤ 53.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 9-oxofluorene-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

anthracene-9,10-dione;carbonochloridic acid
CID 88712965
12-(9-oxofluorene-4-carbonyl)oxydodecyl 9-oxofluorene-4-carboxylate
CID 122493784
benzyl 9-oxofluorene-4-carboxylate
CID 21241008
anthracene-9,10-dione;phthalic acid
CID 158904853
N-methyl-9,10-dioxoanthracene-1-carboxamide
CID 71365214
2-(dimethylamino)ethyl 9-oxofluorene-4-carboxylate
CID 7730694
N-(9,10-dioxoanthracen-1-yl)-9,10-dioxoanthracene-1-carboxamide
CID 3343697
2-[(9-oxofluorene-4-carbonyl)amino]-3-phenylpropanoic acid
CID 4908821
2-(2,3,4,5,6-pentafluorophenyl)benzoyl chloride
CID 87415927
(9-oxofluoren-4-yl)boronic acid
CID 67270754
benzene-1,2-dicarbonyl chloride;thiohypochlorous acid
CID 172771249
4-methyl-2-[(9-oxofluorene-4-carbonyl)amino]pentanoic acid
CID 4974681

Frequently Asked Questions

What is the IUPAC name of 9-oxofluorene-4-carbonyl chloride?
The IUPAC name of 9-oxofluorene-4-carbonyl chloride (CID 610142) is 9-oxofluorene-4-carbonyl chloride.
What is the SMILES notation for 9-oxofluorene-4-carbonyl chloride?
The canonical SMILES for 9-oxofluorene-4-carbonyl chloride is O=C(Cl)c1cccc2c1-c1ccccc1C2=O.
What is the InChIKey of 9-oxofluorene-4-carbonyl chloride?
The InChIKey is XKCGWCQMEUASJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7ClO2/c15-14(17)11-7-3-6-10-12(11)8-4-1-2-5-9(8)13(10)16/h1-7H.
What are the key properties of 9-oxofluorene-4-carbonyl chloride?
9-oxofluorene-4-carbonyl chloride has a molecular weight of 242.66 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxofluorene-4-carbonyl chloride is sourced from PubChem (CID 610142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).