C18H22N4O6 — CID 168539386
2,2-dimethyl-5-[(2-methyl-4-nitro-5-piperazin-1-ylanilino)methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168539386) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(2-methyl-4-nitro-5-piperazin-1-ylanilino)methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(2-methyl-4-nitro-5-piperazin-1-ylanilino)methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168539386 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2,2-dimethyl-5-[(2-methyl-4-nitro-5-piperazin-1-ylanilino)methylidene]-1,3-dioxane-4,6-dione |
| SMILES | Cc1cc([N+](=O)[O-])c(N2CCNCC2)cc1NC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C18H22N4O6/c1-11-8-15(22(25)26)14(21-6-4-19-5-7-21)9-13(11)20-10-12-16(23)27-18(2,3)28-17(12)24/h8-10,19-20H,4-7H2,1-3H3 |
| InChIKey | JTINWLTZWKFLLC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|