C22H40N10O4 — CID 11713183
1-[2,4-dinitro-5-(1,4,7,10-tetrazacyclododec-1-yl)phenyl]-1,4,7,10-tetrazacyclododecane (PubChem CID 11713183) has the molecular formula C22H40N10O4 and a molecular weight of 508.63 g/mol. Its IUPAC name is 1-[2,4-dinitro-5-(1,4,7,10-tetrazacyclododec-1-yl)phenyl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1-[2,4-dinitro-5-(1,4,7,10-tetrazacyclododec-1-yl)phenyl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 11713183 |
| Molecular Formula | C22H40N10O4 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | 1-[2,4-dinitro-5-(1,4,7,10-tetrazacyclododec-1-yl)phenyl]-1,4,7,10-tetrazacyclododecane |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(N2CCNCCNCCNCC2)cc1N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C22H40N10O4/c33-31(34)21-18-22(32(35)36)20(30-15-11-27-7-3-24-4-8-28-12-16-30)17-19(21)29-13-9-25-5-1-23-2-6-26-10-14-29/h17-18,23-28H,1-16H2 |
| InChIKey | UKCGOUDLSKMDGD-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|