C14H18N4O4S2 — CID 3114929
4-(2,4-dinitro-5-thiomorpholin-4-ylphenyl)thiomorpholine (PubChem CID 3114929) has the molecular formula C14H18N4O4S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 4-(2,4-dinitro-5-thiomorpholin-4-ylphenyl)thiomorpholine.
| Compound Name | 4-(2,4-dinitro-5-thiomorpholin-4-ylphenyl)thiomorpholine |
|---|---|
| PubChem CID | 3114929 |
| Molecular Formula | C14H18N4O4S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-(2,4-dinitro-5-thiomorpholin-4-ylphenyl)thiomorpholine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(N2CCSCC2)cc1N1CCSCC1 |
| InChI | InChI=1S/C14H18N4O4S2/c19-17(20)13-10-14(18(21)22)12(16-3-7-24-8-4-16)9-11(13)15-1-5-23-6-2-15/h9-10H,1-8H2 |
| InChIKey | FFKBLBWANVSIOC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|