C21H22F2N2O3 — CID 5303629
methyl 3-[(2,6-difluorobenzoyl)amino]-4-(4-methylpiperidin-1-yl)benzoate (PubChem CID 5303629) has the molecular formula C21H22F2N2O3 and a molecular weight of 388.41 g/mol. Its IUPAC name is methyl 3-[(2,6-difluorobenzoyl)amino]-4-(4-methylpiperidin-1-yl)benzoate.
| Compound Name | methyl 3-[(2,6-difluorobenzoyl)amino]-4-(4-methylpiperidin-1-yl)benzoate |
|---|---|
| PubChem CID | 5303629 |
| Molecular Formula | C21H22F2N2O3 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl 3-[(2,6-difluorobenzoyl)amino]-4-(4-methylpiperidin-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CCC(C)CC2)c(NC(=O)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C21H22F2N2O3/c1-13-8-10-25(11-9-13)18-7-6-14(21(27)28-2)12-17(18)24-20(26)19-15(22)4-3-5-16(19)23/h3-7,12-13H,8-11H2,1-2H3,(H,24,26) |
| InChIKey | JMISREMQNCRIFF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |