C13H13N3 — CID 168543102
2-[(2,4,5-trimethylanilino)methylidene]propanedinitrile (PubChem CID 168543102) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-[(2,4,5-trimethylanilino)methylidene]propanedinitrile.
| Compound Name | 2-[(2,4,5-trimethylanilino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543102 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-[(2,4,5-trimethylanilino)methylidene]propanedinitrile |
| SMILES | Cc1cc(C)c(NC=C(C#N)C#N)cc1C |
| InChI | InChI=1S/C13H13N3/c1-9-4-11(3)13(5-10(9)2)16-8-12(6-14)7-15/h4-5,8,16H,1-3H3 |
| InChIKey | FZMMNZDTDMONHY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|