C12H7F4N3O — CID 168544868
2-[[5-fluoro-2-methyl-4-(trifluoromethoxy)anilino]methylidene]propanedinitrile (PubChem CID 168544868) has the molecular formula C12H7F4N3O and a molecular weight of 285.20 g/mol. Its IUPAC name is 2-[[5-fluoro-2-methyl-4-(trifluoromethoxy)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[5-fluoro-2-methyl-4-(trifluoromethoxy)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544868 |
| Molecular Formula | C12H7F4N3O |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-[[5-fluoro-2-methyl-4-(trifluoromethoxy)anilino]methylidene]propanedinitrile |
| SMILES | Cc1cc(OC(F)(F)F)c(F)cc1NC=C(C#N)C#N |
| InChI | InChI=1S/C12H7F4N3O/c1-7-2-11(20-12(14,15)16)9(13)3-10(7)19-6-8(4-17)5-18/h2-3,6,19H,1H3 |
| InChIKey | ZJZDYYIZFDNJED-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|