C12H5F6N3O — CID 168543634
2-[[4-(trifluoromethoxy)-2-(trifluoromethyl)anilino]methylidene]propanedinitrile (PubChem CID 168543634) has the molecular formula C12H5F6N3O and a molecular weight of 321.18 g/mol. Its IUPAC name is 2-[[4-(trifluoromethoxy)-2-(trifluoromethyl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(trifluoromethoxy)-2-(trifluoromethyl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543634 |
| Molecular Formula | C12H5F6N3O |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-[[4-(trifluoromethoxy)-2-(trifluoromethyl)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(OC(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H5F6N3O/c13-11(14,15)9-3-8(22-12(16,17)18)1-2-10(9)21-6-7(4-19)5-20/h1-3,6,21H |
| InChIKey | TYCRTBLWQKCNPM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|