C12H6Cl2F3N3O — CID 168542734
2-[[2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)anilino]methylidene]propanedinitrile (PubChem CID 168542734) has the molecular formula C12H6Cl2F3N3O and a molecular weight of 336.10 g/mol. Its IUPAC name is 2-[[2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542734 |
| Molecular Formula | C12H6Cl2F3N3O |
| Molecular Weight | 336.10 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 2-[[2-chloro-5-(2-chloro-1,1,2-trifluoroethoxy)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1cc(OC(F)(F)C(F)Cl)ccc1Cl |
| InChI | InChI=1S/C12H6Cl2F3N3O/c13-9-2-1-8(21-12(16,17)11(14)15)3-10(9)20-6-7(4-18)5-19/h1-3,6,11,20H |
| InChIKey | VAZJDMGHRYXLDI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.10 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|