C8H5BrClF3O2 — CID 13228506
2-bromo-4-(2-chloro-1,1,2-trifluoroethoxy)phenol (PubChem CID 13228506) has the molecular formula C8H5BrClF3O2 and a molecular weight of 305.48 g/mol. Its IUPAC name is 2-bromo-4-(2-chloro-1,1,2-trifluoroethoxy)phenol.
| Compound Name | 2-bromo-4-(2-chloro-1,1,2-trifluoroethoxy)phenol |
|---|---|
| PubChem CID | 13228506 |
| Molecular Formula | C8H5BrClF3O2 |
| Molecular Weight | 305.48 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | 2-bromo-4-(2-chloro-1,1,2-trifluoroethoxy)phenol |
| SMILES | Oc1ccc(OC(F)(F)C(F)Cl)cc1Br |
| InChI | InChI=1S/C8H5BrClF3O2/c9-5-3-4(1-2-6(5)14)15-8(12,13)7(10)11/h1-3,7,14H |
| InChIKey | LPFOVJYSNFRPHU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|