C8H7BrF3NO — CID 66510341
4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-bromophenol (PubChem CID 66510341) has the molecular formula C8H7BrF3NO and a molecular weight of 270.05 g/mol. Its IUPAC name is 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-bromophenol.
| Compound Name | 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-bromophenol |
|---|---|
| PubChem CID | 66510341 |
| Molecular Formula | C8H7BrF3NO |
| Molecular Weight | 270.05 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-bromophenol |
| SMILES | N[C@H](c1ccc(O)c(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C8H7BrF3NO/c9-5-3-4(1-2-6(5)14)7(13)8(10,11)12/h1-3,7,14H,13H2/t7-/m1/s1 |
| InChIKey | WMEQOAHOFXHHRD-SSDOTTSWSA-N |
| XLogP | 2.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.05 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |