C8H9ClF3NO — CID 138107889
4-(1-amino-2,2,2-trifluoroethyl)phenol;hydrochloride (PubChem CID 138107889) has the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. Its IUPAC name is 4-(1-amino-2,2,2-trifluoroethyl)phenol;hydrochloride.
| Compound Name | 4-(1-amino-2,2,2-trifluoroethyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 138107889 |
| Molecular Formula | C8H9ClF3NO |
| Molecular Weight | 227.61 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-(1-amino-2,2,2-trifluoroethyl)phenol;hydrochloride |
| SMILES | Cl.NC(c1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO.ClH/c9-8(10,11)7(12)5-1-3-6(13)4-2-5;/h1-4,7,13H,12H2;1H |
| InChIKey | JDMQNFSWVGXQKQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |