C8H6BrF3O2 — CID 83952334
2-bromo-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol (PubChem CID 83952334) has the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. Its IUPAC name is 2-bromo-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol.
| Compound Name | 2-bromo-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol |
|---|---|
| PubChem CID | 83952334 |
| Molecular Formula | C8H6BrF3O2 |
| Molecular Weight | 271.03 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | 2-bromo-4-(2,2,2-trifluoro-1-hydroxyethyl)phenol |
| SMILES | Oc1ccc(C(O)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C8H6BrF3O2/c9-5-3-4(1-2-6(5)13)7(14)8(10,11)12/h1-3,7,13-14H |
| InChIKey | FFIJWZBQHJVNLW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.03 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |