C8H5Cl2F2NO4 — CID 154400652
4-(2,2-dichloro-1,1-difluoroethoxy)-2-nitrophenol (PubChem CID 154400652) has the molecular formula C8H5Cl2F2NO4 and a molecular weight of 288.03 g/mol. Its IUPAC name is 4-(2,2-dichloro-1,1-difluoroethoxy)-2-nitrophenol.
| Compound Name | 4-(2,2-dichloro-1,1-difluoroethoxy)-2-nitrophenol |
|---|---|
| PubChem CID | 154400652 |
| Molecular Formula | C8H5Cl2F2NO4 |
| Molecular Weight | 288.03 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 4-(2,2-dichloro-1,1-difluoroethoxy)-2-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(OC(F)(F)C(Cl)Cl)ccc1O |
| InChI | InChI=1S/C8H5Cl2F2NO4/c9-7(10)8(11,12)17-4-1-2-6(14)5(3-4)13(15)16/h1-3,7,14H |
| InChIKey | UGFNVHHNIFNITB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.03 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|