C8H6Cl2F2O2 — CID 154087912
3-(2,2-dichloro-1,1-difluoroethoxy)phenol (PubChem CID 154087912) has the molecular formula C8H6Cl2F2O2 and a molecular weight of 243.04 g/mol. Its IUPAC name is 3-(2,2-dichloro-1,1-difluoroethoxy)phenol.
| Compound Name | 3-(2,2-dichloro-1,1-difluoroethoxy)phenol |
|---|---|
| PubChem CID | 154087912 |
| Molecular Formula | C8H6Cl2F2O2 |
| Molecular Weight | 243.04 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 3-(2,2-dichloro-1,1-difluoroethoxy)phenol |
| SMILES | Oc1cccc(OC(F)(F)C(Cl)Cl)c1 |
| InChI | InChI=1S/C8H6Cl2F2O2/c9-7(10)8(11,12)14-6-3-1-2-5(13)4-6/h1-4,7,13H |
| InChIKey | IFSDZBRPHWSTNG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.04 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|