C9H7BrCl2F2O4S — CID 154159327
[3-(2,2-dichloro-1,1-difluoroethoxy)phenyl] bromomethanesulfonate (PubChem CID 154159327) has the molecular formula C9H7BrCl2F2O4S and a molecular weight of 400.02 g/mol. Its IUPAC name is [3-(2,2-dichloro-1,1-difluoroethoxy)phenyl] bromomethanesulfonate.
| Compound Name | [3-(2,2-dichloro-1,1-difluoroethoxy)phenyl] bromomethanesulfonate |
|---|---|
| PubChem CID | 154159327 |
| Molecular Formula | C9H7BrCl2F2O4S |
| Molecular Weight | 400.02 g/mol |
| Exact Mass | 397.86 |
| IUPAC Name | [3-(2,2-dichloro-1,1-difluoroethoxy)phenyl] bromomethanesulfonate |
| SMILES | O=S(=O)(CBr)Oc1cccc(OC(F)(F)C(Cl)Cl)c1 |
| InChI | InChI=1S/C9H7BrCl2F2O4S/c10-5-19(15,16)18-7-3-1-2-6(4-7)17-9(13,14)8(11)12/h1-4,8H,5H2 |
| InChIKey | ROPOZSFKARIVMV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.02 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|