C18H19F3O5S — CID 20738786
[3-[2-(trifluoromethoxy)phenoxy]phenyl] pentane-1-sulfonate (PubChem CID 20738786) has the molecular formula C18H19F3O5S and a molecular weight of 404.41 g/mol. Its IUPAC name is [3-[2-(trifluoromethoxy)phenoxy]phenyl] pentane-1-sulfonate.
| Compound Name | [3-[2-(trifluoromethoxy)phenoxy]phenyl] pentane-1-sulfonate |
|---|---|
| PubChem CID | 20738786 |
| Molecular Formula | C18H19F3O5S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [3-[2-(trifluoromethoxy)phenoxy]phenyl] pentane-1-sulfonate |
| SMILES | CCCCCS(=O)(=O)Oc1cccc(Oc2ccccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F3O5S/c1-2-3-6-12-27(22,23)26-15-9-7-8-14(13-15)24-16-10-4-5-11-17(16)25-18(19,20)21/h4-5,7-11,13H,2-3,6,12H2,1H3 |
| InChIKey | FOJXXJWFKUDPCQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|