C21H24F3NO4S — CID 59897959
[3-[(2-propyl-1,3-dihydroisoindol-4-yl)oxy]phenyl] 4,4,4-trifluorobutane-1-sulfonate (PubChem CID 59897959) has the molecular formula C21H24F3NO4S and a molecular weight of 443.49 g/mol. Its IUPAC name is [3-[(2-propyl-1,3-dihydroisoindol-4-yl)oxy]phenyl] 4,4,4-trifluorobutane-1-sulfonate.
| Compound Name | [3-[(2-propyl-1,3-dihydroisoindol-4-yl)oxy]phenyl] 4,4,4-trifluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 59897959 |
| Molecular Formula | C21H24F3NO4S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [3-[(2-propyl-1,3-dihydroisoindol-4-yl)oxy]phenyl] 4,4,4-trifluorobutane-1-sulfonate |
| SMILES | CCCN1Cc2cccc(Oc3cccc(OS(=O)(=O)CCCC(F)(F)F)c3)c2C1 |
| InChI | InChI=1S/C21H24F3NO4S/c1-2-11-25-14-16-6-3-9-20(19(16)15-25)28-17-7-4-8-18(13-17)29-30(26,27)12-5-10-21(22,23)24/h3-4,6-9,13H,2,5,10-12,14-15H2,1H3 |
| InChIKey | HORQFNJXUJWBBH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|