C16H14F3NO5S — CID 20816476
[3-(3-nitrophenyl)phenyl] 4,4,4-trifluorobutane-1-sulfonate (PubChem CID 20816476) has the molecular formula C16H14F3NO5S and a molecular weight of 389.35 g/mol. Its IUPAC name is [3-(3-nitrophenyl)phenyl] 4,4,4-trifluorobutane-1-sulfonate.
| Compound Name | [3-(3-nitrophenyl)phenyl] 4,4,4-trifluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 20816476 |
| Molecular Formula | C16H14F3NO5S |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [3-(3-nitrophenyl)phenyl] 4,4,4-trifluorobutane-1-sulfonate |
| SMILES | O=[N+]([O-])c1cccc(-c2cccc(OS(=O)(=O)CCCC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H14F3NO5S/c17-16(18,19)8-3-9-26(23,24)25-15-7-2-5-13(11-15)12-4-1-6-14(10-12)20(21)22/h1-2,4-7,10-11H,3,8-9H2 |
| InChIKey | NXXRGCCVMWUQEO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|