C19H20BrF3O2 — CID 142130878
1-bromo-2-methyl-3-[3-(6,6,6-trifluorohexoxy)phenoxy]benzene (PubChem CID 142130878) has the molecular formula C19H20BrF3O2 and a molecular weight of 417.27 g/mol. Its IUPAC name is 1-bromo-2-methyl-3-[3-(6,6,6-trifluorohexoxy)phenoxy]benzene.
| Compound Name | 1-bromo-2-methyl-3-[3-(6,6,6-trifluorohexoxy)phenoxy]benzene |
|---|---|
| PubChem CID | 142130878 |
| Molecular Formula | C19H20BrF3O2 |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 1-bromo-2-methyl-3-[3-(6,6,6-trifluorohexoxy)phenoxy]benzene |
| SMILES | Cc1c(Br)cccc1Oc1cccc(OCCCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C19H20BrF3O2/c1-14-17(20)9-6-10-18(14)25-16-8-5-7-15(13-16)24-12-4-2-3-11-19(21,22)23/h5-10,13H,2-4,11-12H2,1H3 |
| InChIKey | RFHUFCDUIUVNLN-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|