C12H14BrF3O — CID 115828367
1-(3-bromo-2-methylphenyl)-5,5,5-trifluoropentan-1-ol (PubChem CID 115828367) has the molecular formula C12H14BrF3O and a molecular weight of 311.14 g/mol. Its IUPAC name is 1-(3-bromo-2-methylphenyl)-5,5,5-trifluoropentan-1-ol.
| Compound Name | 1-(3-bromo-2-methylphenyl)-5,5,5-trifluoropentan-1-ol |
|---|---|
| PubChem CID | 115828367 |
| Molecular Formula | C12H14BrF3O |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 1-(3-bromo-2-methylphenyl)-5,5,5-trifluoropentan-1-ol |
| SMILES | Cc1c(Br)cccc1C(O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H14BrF3O/c1-8-9(4-2-5-10(8)13)11(17)6-3-7-12(14,15)16/h2,4-5,11,17H,3,6-7H2,1H3 |
| InChIKey | NIVUALGBXWYMDM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |