C11H11BrF3IO — CID 114027276
1-(2-bromo-5-iodophenyl)-5,5,5-trifluoropentan-1-ol (PubChem CID 114027276) has the molecular formula C11H11BrF3IO and a molecular weight of 423.01 g/mol. Its IUPAC name is 1-(2-bromo-5-iodophenyl)-5,5,5-trifluoropentan-1-ol.
| Compound Name | 1-(2-bromo-5-iodophenyl)-5,5,5-trifluoropentan-1-ol |
|---|---|
| PubChem CID | 114027276 |
| Molecular Formula | C11H11BrF3IO |
| Molecular Weight | 423.01 g/mol |
| Exact Mass | 421.90 |
| IUPAC Name | 1-(2-bromo-5-iodophenyl)-5,5,5-trifluoropentan-1-ol |
| SMILES | OC(CCCC(F)(F)F)c1cc(I)ccc1Br |
| InChI | InChI=1S/C11H11BrF3IO/c12-9-4-3-7(16)6-8(9)10(17)2-1-5-11(13,14)15/h3-4,6,10,17H,1-2,5H2 |
| InChIKey | XBBIJJKEWRGCSL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.01 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|