C14H21BrIN — CID 114210895
1-(2-bromo-5-iodophenyl)-5,5-dimethylhexan-1-amine (PubChem CID 114210895) has the molecular formula C14H21BrIN and a molecular weight of 410.14 g/mol. Its IUPAC name is 1-(2-bromo-5-iodophenyl)-5,5-dimethylhexan-1-amine.
| Compound Name | 1-(2-bromo-5-iodophenyl)-5,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 114210895 |
| Molecular Formula | C14H21BrIN |
| Molecular Weight | 410.14 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 1-(2-bromo-5-iodophenyl)-5,5-dimethylhexan-1-amine |
| SMILES | CC(C)(C)CCCC(N)c1cc(I)ccc1Br |
| InChI | InChI=1S/C14H21BrIN/c1-14(2,3)8-4-5-13(17)11-9-10(16)6-7-12(11)15/h6-7,9,13H,4-5,8,17H2,1-3H3 |
| InChIKey | VUEIZJJUSNQXBK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.14 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|