C10H14ClFINO — CID 171216213
(4R)-4-amino-4-(2-fluoro-5-iodophenyl)butan-1-ol;hydrochloride (PubChem CID 171216213) has the molecular formula C10H14ClFINO and a molecular weight of 345.58 g/mol. Its IUPAC name is (4R)-4-amino-4-(2-fluoro-5-iodophenyl)butan-1-ol;hydrochloride.
| Compound Name | (4R)-4-amino-4-(2-fluoro-5-iodophenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171216213 |
| Molecular Formula | C10H14ClFINO |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | (4R)-4-amino-4-(2-fluoro-5-iodophenyl)butan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H](CCCO)c1cc(I)ccc1F |
| InChI | InChI=1S/C10H13FINO.ClH/c11-9-4-3-7(12)6-8(9)10(13)2-1-5-14;/h3-4,6,10,14H,1-2,5,13H2;1H/t10-;/m1./s1 |
| InChIKey | NRMVCAQYDWSTNY-HNCPQSOCSA-N |
| XLogP | 2.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|