C9H12FIN2 — CID 131016633
(1R)-1-(2-fluoro-5-iodophenyl)propane-1,3-diamine (PubChem CID 131016633) has the molecular formula C9H12FIN2 and a molecular weight of 294.11 g/mol. Its IUPAC name is (1R)-1-(2-fluoro-5-iodophenyl)propane-1,3-diamine.
| Compound Name | (1R)-1-(2-fluoro-5-iodophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 131016633 |
| Molecular Formula | C9H12FIN2 |
| Molecular Weight | 294.11 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | (1R)-1-(2-fluoro-5-iodophenyl)propane-1,3-diamine |
| SMILES | NCC[C@@H](N)c1cc(I)ccc1F |
| InChI | InChI=1S/C9H12FIN2/c10-8-2-1-6(11)5-7(8)9(13)3-4-12/h1-2,5,9H,3-4,12-13H2/t9-/m1/s1 |
| InChIKey | MIWOIHHABDRTKH-SECBINFHSA-N |
| XLogP | 1.78 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|