C10H14FIN2 — CID 171235808
(1S)-1-(2-fluoro-5-iodophenyl)butane-1,4-diamine (PubChem CID 171235808) has the molecular formula C10H14FIN2 and a molecular weight of 308.14 g/mol. Its IUPAC name is (1S)-1-(2-fluoro-5-iodophenyl)butane-1,4-diamine.
| Compound Name | (1S)-1-(2-fluoro-5-iodophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171235808 |
| Molecular Formula | C10H14FIN2 |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | (1S)-1-(2-fluoro-5-iodophenyl)butane-1,4-diamine |
| SMILES | NCCC[C@H](N)c1cc(I)ccc1F |
| InChI | InChI=1S/C10H14FIN2/c11-9-4-3-7(12)6-8(9)10(14)2-1-5-13/h3-4,6,10H,1-2,5,13-14H2/t10-/m0/s1 |
| InChIKey | VVYBXGAHFAUART-JTQLQIEISA-N |
| XLogP | 2.17 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|