C9H10ClF3INO — CID 171245024
(3R)-3-amino-2,2-difluoro-3-(2-fluoro-5-iodophenyl)propan-1-ol;hydrochloride (PubChem CID 171245024) has the molecular formula C9H10ClF3INO and a molecular weight of 367.54 g/mol. Its IUPAC name is (3R)-3-amino-2,2-difluoro-3-(2-fluoro-5-iodophenyl)propan-1-ol;hydrochloride.
| Compound Name | (3R)-3-amino-2,2-difluoro-3-(2-fluoro-5-iodophenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171245024 |
| Molecular Formula | C9H10ClF3INO |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | (3R)-3-amino-2,2-difluoro-3-(2-fluoro-5-iodophenyl)propan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(I)ccc1F)C(F)(F)CO |
| InChI | InChI=1S/C9H9F3INO.ClH/c10-7-2-1-5(13)3-6(7)8(14)9(11,12)4-15;/h1-3,8,15H,4,14H2;1H/t8-;/m1./s1 |
| InChIKey | UEABCJONKAWDHI-DDWIOCJRSA-N |
| XLogP | 2.48 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|