C11H16ClFINO — CID 171266075
(1R,2S)-1-amino-1-(2-fluoro-5-iodophenyl)-3-methylbutan-2-ol;hydrochloride (PubChem CID 171266075) has the molecular formula C11H16ClFINO and a molecular weight of 359.61 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2-fluoro-5-iodophenyl)-3-methylbutan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(2-fluoro-5-iodophenyl)-3-methylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171266075 |
| Molecular Formula | C11H16ClFINO |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | (1R,2S)-1-amino-1-(2-fluoro-5-iodophenyl)-3-methylbutan-2-ol;hydrochloride |
| SMILES | CC(C)[C@H](O)[C@H](N)c1cc(I)ccc1F.Cl |
| InChI | InChI=1S/C11H15FINO.ClH/c1-6(2)11(15)10(14)8-5-7(13)3-4-9(8)12;/h3-6,10-11,15H,14H2,1-2H3;1H/t10-,11+;/m1./s1 |
| InChIKey | YNZBIOJEEHZRJR-DHXVBOOMSA-N |
| XLogP | 2.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|