C11H16ClI2NO2 — CID 171271648
2-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-4,6-diiodophenol;hydrochloride (PubChem CID 171271648) has the molecular formula C11H16ClI2NO2 and a molecular weight of 483.52 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-4,6-diiodophenol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-4,6-diiodophenol;hydrochloride |
|---|---|
| PubChem CID | 171271648 |
| Molecular Formula | C11H16ClI2NO2 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 482.90 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-4,6-diiodophenol;hydrochloride |
| SMILES | CC(C)[C@@H](O)[C@@H](N)c1cc(I)cc(I)c1O.Cl |
| InChI | InChI=1S/C11H15I2NO2.ClH/c1-5(2)10(15)9(14)7-3-6(12)4-8(13)11(7)16;/h3-5,9-10,15-16H,14H2,1-2H3;1H/t9-,10+;/m0./s1 |
| InChIKey | XRUDNTSPBTWTRU-BAUSSPIASA-N |
| XLogP | 3.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|