C9H8F3I2NO2 — CID 171265985
2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]-4,6-diiodophenol (PubChem CID 171265985) has the molecular formula C9H8F3I2NO2 and a molecular weight of 472.97 g/mol. Its IUPAC name is 2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]-4,6-diiodophenol.
| Compound Name | 2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 171265985 |
| Molecular Formula | C9H8F3I2NO2 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.86 |
| IUPAC Name | 2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]-4,6-diiodophenol |
| SMILES | N[C@H](c1cc(I)cc(I)c1O)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C9H8F3I2NO2/c10-9(11,12)8(17)6(15)4-1-3(13)2-5(14)7(4)16/h1-2,6,8,16-17H,15H2/t6-,8-/m1/s1 |
| InChIKey | BGFGVORGLUFWES-HTRCEHHLSA-N |
| XLogP | 2.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|