C9H12ClI2NO2 — CID 171271638
2-[(1S,2R)-1-amino-2-hydroxypropyl]-4,6-diiodophenol;hydrochloride (PubChem CID 171271638) has the molecular formula C9H12ClI2NO2 and a molecular weight of 455.46 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxypropyl]-4,6-diiodophenol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxypropyl]-4,6-diiodophenol;hydrochloride |
|---|---|
| PubChem CID | 171271638 |
| Molecular Formula | C9H12ClI2NO2 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 454.86 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxypropyl]-4,6-diiodophenol;hydrochloride |
| SMILES | C[C@@H](O)[C@@H](N)c1cc(I)cc(I)c1O.Cl |
| InChI | InChI=1S/C9H11I2NO2.ClH/c1-4(13)8(12)6-2-5(10)3-7(11)9(6)14;/h2-4,8,13-14H,12H2,1H3;1H/t4-,8-;/m1./s1 |
| InChIKey | RMLJKLIWXSRFLY-RURBIERHSA-N |
| XLogP | 2.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|