C12H15I2NO2 — CID 171265975
2-[(1R,2S)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4,6-diiodophenol (PubChem CID 171265975) has the molecular formula C12H15I2NO2 and a molecular weight of 459.07 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4,6-diiodophenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 171265975 |
| Molecular Formula | C12H15I2NO2 |
| Molecular Weight | 459.07 g/mol |
| Exact Mass | 458.92 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-cyclobutyl-2-hydroxyethyl]-4,6-diiodophenol |
| SMILES | N[C@H](c1cc(I)cc(I)c1O)[C@@H](O)C1CCC1 |
| InChI | InChI=1S/C12H15I2NO2/c13-7-4-8(12(17)9(14)5-7)10(15)11(16)6-2-1-3-6/h4-6,10-11,16-17H,1-3,15H2/t10-,11+/m1/s1 |
| InChIKey | PNOHJNDLKRXKAH-MNOVXSKESA-N |
| XLogP | 2.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.07 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|