C13H17I2NO — CID 171235517
2-[(S)-amino(cyclohexyl)methyl]-4,6-diiodophenol (PubChem CID 171235517) has the molecular formula C13H17I2NO and a molecular weight of 457.09 g/mol. Its IUPAC name is 2-[(S)-amino(cyclohexyl)methyl]-4,6-diiodophenol.
| Compound Name | 2-[(S)-amino(cyclohexyl)methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 171235517 |
| Molecular Formula | C13H17I2NO |
| Molecular Weight | 457.09 g/mol |
| Exact Mass | 456.94 |
| IUPAC Name | 2-[(S)-amino(cyclohexyl)methyl]-4,6-diiodophenol |
| SMILES | N[C@H](c1cc(I)cc(I)c1O)C1CCCCC1 |
| InChI | InChI=1S/C13H17I2NO/c14-9-6-10(13(17)11(15)7-9)12(16)8-4-2-1-3-5-8/h6-8,12,17H,1-5,16H2/t12-/m0/s1 |
| InChIKey | IIBQTKIBROEGIW-LBPRGKRZSA-N |
| XLogP | 4.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.09 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|