C12H17I2NO2 — CID 171271657
2-[(1S,2R)-1-amino-2-hydroxyhexyl]-4,6-diiodophenol (PubChem CID 171271657) has the molecular formula C12H17I2NO2 and a molecular weight of 461.08 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxyhexyl]-4,6-diiodophenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxyhexyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 171271657 |
| Molecular Formula | C12H17I2NO2 |
| Molecular Weight | 461.08 g/mol |
| Exact Mass | 460.93 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxyhexyl]-4,6-diiodophenol |
| SMILES | CCCC[C@@H](O)[C@@H](N)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C12H17I2NO2/c1-2-3-4-10(16)11(15)8-5-7(13)6-9(14)12(8)17/h5-6,10-11,16-17H,2-4,15H2,1H3/t10-,11+/m1/s1 |
| InChIKey | NZPWFNFVXOYNQC-MNOVXSKESA-N |
| XLogP | 3.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.08 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|