C13H20IN — CID 112630998
1-(4-iodophenyl)-4,4-dimethylpentan-1-amine (PubChem CID 112630998) has the molecular formula C13H20IN and a molecular weight of 317.21 g/mol. Its IUPAC name is 1-(4-iodophenyl)-4,4-dimethylpentan-1-amine.
| Compound Name | 1-(4-iodophenyl)-4,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 112630998 |
| Molecular Formula | C13H20IN |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 1-(4-iodophenyl)-4,4-dimethylpentan-1-amine |
| SMILES | CC(C)(C)CCC(N)c1ccc(I)cc1 |
| InChI | InChI=1S/C13H20IN/c1-13(2,3)9-8-12(15)10-4-6-11(14)7-5-10/h4-7,12H,8-9,15H2,1-3H3 |
| InChIKey | ZCRHTQQVIIJMCL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|