C14H13I2N — CID 115863933
1,2-bis(4-iodophenyl)ethanamine (PubChem CID 115863933) has the molecular formula C14H13I2N and a molecular weight of 449.07 g/mol. Its IUPAC name is 1,2-bis(4-iodophenyl)ethanamine.
| Compound Name | 1,2-bis(4-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 115863933 |
| Molecular Formula | C14H13I2N |
| Molecular Weight | 449.07 g/mol |
| Exact Mass | 448.91 |
| IUPAC Name | 1,2-bis(4-iodophenyl)ethanamine |
| SMILES | NC(Cc1ccc(I)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H13I2N/c15-12-5-1-10(2-6-12)9-14(17)11-3-7-13(16)8-4-11/h1-8,14H,9,17H2 |
| InChIKey | OMYKFDIACYJVOZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.07 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|