C16H18INO2 — CID 61079391
2-(3,4-dimethoxyphenyl)-1-(4-iodophenyl)ethanamine (PubChem CID 61079391) has the molecular formula C16H18INO2 and a molecular weight of 383.23 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-(4-iodophenyl)ethanamine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-(4-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 61079391 |
| Molecular Formula | C16H18INO2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-(4-iodophenyl)ethanamine |
| SMILES | COc1ccc(CC(N)c2ccc(I)cc2)cc1OC |
| InChI | InChI=1S/C16H18INO2/c1-19-15-8-3-11(10-16(15)20-2)9-14(18)12-4-6-13(17)7-5-12/h3-8,10,14H,9,18H2,1-2H3 |
| InChIKey | WJNKBQIRYIHOOI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|